About 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine
1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine (PubChem CID 64940782) has the molecular formula C16H24BrClN2
and a molecular weight of 359.74 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine.
Molecular Properties
| Compound Name | 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine |
| PubChem CID | 64940782 |
| Molecular Formula | C16H24BrClN2 |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine |
| SMILES | CCC1CNC(CC)(CC)CN1c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C16H24BrClN2/c1-4-13-10-19-16(5-2,6-3)11-20(13)15-9-12(17)7-8-14(15)18/h7-9,13,19H,4-6,10-11H2,1-3H3 |
| InChIKey | OSLDTJHQSUQGSW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine?
The IUPAC name of 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine (CID 64940782) is 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine.
What is the SMILES notation for 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine?
The canonical SMILES for 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine is CCC1CNC(CC)(CC)CN1c1cc(Br)ccc1Cl.
What is the InChIKey of 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine?
The InChIKey is OSLDTJHQSUQGSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24BrClN2/c1-4-13-10-19-16(5-2,6-3)11-20(13)15-9-12(17)7-8-14(15)18/h7-9,13,19H,4-6,10-11H2,1-3H3.
What are the key properties of 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine?
1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine has a molecular weight of 359.74 g/mol, XLogP of 4.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2-chlorophenyl)-2,5,5-triethylpiperazine is sourced from PubChem (CID 64940782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).