About 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane
11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane (PubChem CID 64941322) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane |
| PubChem CID | 64941322 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane |
| SMILES | c1cncc(N2CCCNC3(CCCCC3)C2)c1 |
| InChI | InChI=1S/C15H23N3/c1-2-7-15(8-3-1)13-18(11-5-10-17-15)14-6-4-9-16-12-14/h4,6,9,12,17H,1-3,5,7-8,10-11,13H2 |
| InChIKey | DORLORVEFNUWHI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane?
The IUPAC name of 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane (CID 64941322) is 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane.
What is the SMILES notation for 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane?
The canonical SMILES for 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane is c1cncc(N2CCCNC3(CCCCC3)C2)c1.
What is the InChIKey of 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane?
The InChIKey is DORLORVEFNUWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3/c1-2-7-15(8-3-1)13-18(11-5-10-17-15)14-6-4-9-16-12-14/h4,6,9,12,17H,1-3,5,7-8,10-11,13H2.
What are the key properties of 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane?
11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane has a molecular weight of 245.37 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-pyridin-3-yl-7,11-diazaspiro[5.6]dodecane is sourced from PubChem (CID 64941322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).