About N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide
N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 6494237) has the molecular formula C20H18N4O3S
and a molecular weight of 394.46 g/mol. Its IUPAC name is N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide |
| PubChem CID | 6494237 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)Nc1cccc(-c2cn3cccnc3n2)c1 |
| InChI | InChI=1S/C20H18N4O3S/c1-14-7-8-18(27-2)19(11-14)28(25,26)23-16-6-3-5-15(12-16)17-13-24-10-4-9-21-20(24)22-17/h3-13,23H,1-2H3 |
| InChIKey | LHQRIONPLPPYNC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide?
The IUPAC name of N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide (CID 6494237) is N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide.
What is the SMILES notation for N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide?
The canonical SMILES for N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide is COc1ccc(C)cc1S(=O)(=O)Nc1cccc(-c2cn3cccnc3n2)c1.
What is the InChIKey of N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide?
The InChIKey is LHQRIONPLPPYNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O3S/c1-14-7-8-18(27-2)19(11-14)28(25,26)23-16-6-3-5-15(12-16)17-13-24-10-4-9-21-20(24)22-17/h3-13,23H,1-2H3.
What are the key properties of N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide?
N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide has a molecular weight of 394.46 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-methoxy-5-methylbenzenesulfonamide is sourced from PubChem (CID 6494237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).