About 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline
5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline (PubChem CID 64942773) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline.
Molecular Properties
| Compound Name | 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline |
| PubChem CID | 64942773 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline |
| SMILES | CC(C)C1CN(c2cccc3cnccc23)CCCN1 |
| InChI | InChI=1S/C17H23N3/c1-13(2)16-12-20(10-4-8-19-16)17-6-3-5-14-11-18-9-7-15(14)17/h3,5-7,9,11,13,16,19H,4,8,10,12H2,1-2H3 |
| InChIKey | HKRWMRQTFMVWHE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline?
The IUPAC name of 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline (CID 64942773) is 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline.
What is the SMILES notation for 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline?
The canonical SMILES for 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline is CC(C)C1CN(c2cccc3cnccc23)CCCN1.
What is the InChIKey of 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline?
The InChIKey is HKRWMRQTFMVWHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3/c1-13(2)16-12-20(10-4-8-19-16)17-6-3-5-14-11-18-9-7-15(14)17/h3,5-7,9,11,13,16,19H,4,8,10,12H2,1-2H3.
What are the key properties of 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline?
5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline has a molecular weight of 269.39 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-propan-2-yl-1,4-diazepan-1-yl)isoquinoline is sourced from PubChem (CID 64942773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).