C16H23BrN2 — CID 64942821
10-(5-bromo-2-methylphenyl)-6,10-diazaspiro[4.6]undecane (PubChem CID 64942821) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is 10-(5-bromo-2-methylphenyl)-6,10-diazaspiro[4.6]undecane.
| Compound Name | 10-(5-bromo-2-methylphenyl)-6,10-diazaspiro[4.6]undecane |
|---|---|
| PubChem CID | 64942821 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 10-(5-bromo-2-methylphenyl)-6,10-diazaspiro[4.6]undecane |
| SMILES | Cc1ccc(Br)cc1N1CCCNC2(CCCC2)C1 |
| InChI | InChI=1S/C16H23BrN2/c1-13-5-6-14(17)11-15(13)19-10-4-9-18-16(12-19)7-2-3-8-16/h5-6,11,18H,2-4,7-10,12H2,1H3 |
| InChIKey | CCVLLTPQQBSSGD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |