About ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate
ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 6494320) has the molecular formula C16H19N3O4S
and a molecular weight of 349.41 g/mol. Its IUPAC name is ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| PubChem CID | 6494320 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCCc1nnc(SCC(=O)Nc2ccc(C(=O)OCC)cc2)o1 |
| InChI | InChI=1S/C16H19N3O4S/c1-3-5-14-18-19-16(23-14)24-10-13(20)17-12-8-6-11(7-9-12)15(21)22-4-2/h6-9H,3-5,10H2,1-2H3,(H,17,20) |
| InChIKey | MKZWAKZWQDNCOB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate?
The IUPAC name of ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate (CID 6494320) is ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate.
What is the SMILES notation for ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate?
The canonical SMILES for ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate is CCCc1nnc(SCC(=O)Nc2ccc(C(=O)OCC)cc2)o1.
What is the InChIKey of ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate?
The InChIKey is MKZWAKZWQDNCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4S/c1-3-5-14-18-19-16(23-14)24-10-13(20)17-12-8-6-11(7-9-12)15(21)22-4-2/h6-9H,3-5,10H2,1-2H3,(H,17,20).
What are the key properties of ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate?
ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate has a molecular weight of 349.41 g/mol, XLogP of 2.93, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]benzoate is sourced from PubChem (CID 6494320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).