C15H20F2N2O2 — CID 64943675
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-ethyl-3-methyl-1,4-diazepane (PubChem CID 64943675) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-ethyl-3-methyl-1,4-diazepane.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-ethyl-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 64943675 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-ethyl-3-methyl-1,4-diazepane |
| SMILES | CCC1(C)CN(c2ccc3c(c2)OC(F)(F)O3)CCCN1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-3-14(2)10-19(8-4-7-18-14)11-5-6-12-13(9-11)21-15(16,17)20-12/h5-6,9,18H,3-4,7-8,10H2,1-2H3 |
| InChIKey | RRGRVMQCEYSVGG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|