About 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane
10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane (PubChem CID 64944688) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane.
Molecular Properties
| Compound Name | 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane |
| PubChem CID | 64944688 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane |
| SMILES | CCOCCCN1CCCNC2(CCCC2)C1 |
| InChI | InChI=1S/C14H28N2O/c1-2-17-12-6-11-16-10-5-9-15-14(13-16)7-3-4-8-14/h15H,2-13H2,1H3 |
| InChIKey | DAAXXNNQJKLDQX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane?
The IUPAC name of 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane (CID 64944688) is 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane.
What is the SMILES notation for 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane?
The canonical SMILES for 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane is CCOCCCN1CCCNC2(CCCC2)C1.
What is the InChIKey of 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane?
The InChIKey is DAAXXNNQJKLDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O/c1-2-17-12-6-11-16-10-5-9-15-14(13-16)7-3-4-8-14/h15H,2-13H2,1H3.
What are the key properties of 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane?
10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane has a molecular weight of 240.39 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-ethoxypropyl)-6,10-diazaspiro[4.6]undecane is sourced from PubChem (CID 64944688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).