C14H22N2 — CID 64944864
3-methyl-1-(1-phenylethyl)-1,4-diazepane (PubChem CID 64944864) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-methyl-1-(1-phenylethyl)-1,4-diazepane.
| Compound Name | 3-methyl-1-(1-phenylethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64944864 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 3-methyl-1-(1-phenylethyl)-1,4-diazepane |
| SMILES | CC1CN(C(C)c2ccccc2)CCCN1 |
| InChI | InChI=1S/C14H22N2/c1-12-11-16(10-6-9-15-12)13(2)14-7-4-3-5-8-14/h3-5,7-8,12-13,15H,6,9-11H2,1-2H3 |
| InChIKey | GLJUBZMTNAQDNG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |