About ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate
ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6494536) has the molecular formula C20H23N3O5S
and a molecular weight of 417.49 g/mol. Its IUPAC name is ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 6494536 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C2CC(=O)N(c3ccc(OCC)cc3)C2)nc1C |
| InChI | InChI=1S/C20H23N3O5S/c1-4-27-15-8-6-14(7-9-15)23-11-13(10-16(23)24)18(25)22-20-21-12(3)17(29-20)19(26)28-5-2/h6-9,13H,4-5,10-11H2,1-3H3,(H,21,22,25) |
| InChIKey | RJVLVIGNAXYUSV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (CID 6494536) is ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(NC(=O)C2CC(=O)N(c3ccc(OCC)cc3)C2)nc1C.
What is the InChIKey of ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is RJVLVIGNAXYUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O5S/c1-4-27-15-8-6-14(7-9-15)23-11-13(10-16(23)24)18(25)22-20-21-12(3)17(29-20)19(26)28-5-2/h6-9,13H,4-5,10-11H2,1-3H3,(H,21,22,25).
What are the key properties of ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate?
ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 417.49 g/mol, XLogP of 3.02, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 6494536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).