C18H26N2 — CID 64945602
5-cyclopropyl-1-(2,2-dimethylcyclopropyl)-2-phenylpiperazine (PubChem CID 64945602) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2,2-dimethylcyclopropyl)-2-phenylpiperazine.
| Compound Name | 5-cyclopropyl-1-(2,2-dimethylcyclopropyl)-2-phenylpiperazine |
|---|---|
| PubChem CID | 64945602 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 5-cyclopropyl-1-(2,2-dimethylcyclopropyl)-2-phenylpiperazine |
| SMILES | CC1(C)CC1N1CC(C2CC2)NCC1c1ccccc1 |
| InChI | InChI=1S/C18H26N2/c1-18(2)10-17(18)20-12-15(13-8-9-13)19-11-16(20)14-6-4-3-5-7-14/h3-7,13,15-17,19H,8-12H2,1-2H3 |
| InChIKey | BSMYPQLISLBJJX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |