About 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole
4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole (PubChem CID 64945713) has the molecular formula C14H23N3S
and a molecular weight of 265.43 g/mol. Its IUPAC name is 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole |
| PubChem CID | 64945713 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole |
| SMILES | Cc1csc(CN2CC3(CCCC3)NCC2C)n1 |
| InChI | InChI=1S/C14H23N3S/c1-11-9-18-13(16-11)8-17-10-14(5-3-4-6-14)15-7-12(17)2/h9,12,15H,3-8,10H2,1-2H3 |
| InChIKey | HETZLANBSSCWRL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole?
The IUPAC name of 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole (CID 64945713) is 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole.
What is the SMILES notation for 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole?
The canonical SMILES for 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole is Cc1csc(CN2CC3(CCCC3)NCC2C)n1.
What is the InChIKey of 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole?
The InChIKey is HETZLANBSSCWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3S/c1-11-9-18-13(16-11)8-17-10-14(5-3-4-6-14)15-7-12(17)2/h9,12,15H,3-8,10H2,1-2H3.
What are the key properties of 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole?
4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole has a molecular weight of 265.43 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)methyl]-1,3-thiazole is sourced from PubChem (CID 64945713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).