C17H27FN2 — CID 64946647
5,5-diethyl-1-[1-(4-fluorophenyl)ethyl]-2-methylpiperazine (PubChem CID 64946647) has the molecular formula C17H27FN2 and a molecular weight of 278.42 g/mol. Its IUPAC name is 5,5-diethyl-1-[1-(4-fluorophenyl)ethyl]-2-methylpiperazine.
| Compound Name | 5,5-diethyl-1-[1-(4-fluorophenyl)ethyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 64946647 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 5,5-diethyl-1-[1-(4-fluorophenyl)ethyl]-2-methylpiperazine |
| SMILES | CCC1(CC)CN(C(C)c2ccc(F)cc2)C(C)CN1 |
| InChI | InChI=1S/C17H27FN2/c1-5-17(6-2)12-20(13(3)11-19-17)14(4)15-7-9-16(18)10-8-15/h7-10,13-14,19H,5-6,11-12H2,1-4H3 |
| InChIKey | BISBWIPCFMATLY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |