C15H30N2O2S — CID 64947359
3-[(2,5,5-triethylpiperazin-1-yl)methyl]thiolane 1,1-dioxide (PubChem CID 64947359) has the molecular formula C15H30N2O2S and a molecular weight of 302.48 g/mol. Its IUPAC name is 3-[(2,5,5-triethylpiperazin-1-yl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[(2,5,5-triethylpiperazin-1-yl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64947359 |
| Molecular Formula | C15H30N2O2S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3-[(2,5,5-triethylpiperazin-1-yl)methyl]thiolane 1,1-dioxide |
| SMILES | CCC1CNC(CC)(CC)CN1CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H30N2O2S/c1-4-14-9-16-15(5-2,6-3)12-17(14)10-13-7-8-20(18,19)11-13/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | YHLXWJTXHSSTNA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |