C25H28N2O8 — CID 649478
2-(1,3-benzodioxol-5-ylmethylamino)-1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)ethanone;oxalic acid (PubChem CID 649478) has the molecular formula C25H28N2O8 and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)ethanone;oxalic acid.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)ethanone;oxalic acid |
|---|---|
| PubChem CID | 649478 |
| Molecular Formula | C25H28N2O8 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)ethanone;oxalic acid |
| SMILES | COc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)CNCc1ccc2c(c1)OCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H26N2O4.C2H2O4/c1-15-11-23(2,3)25(19-7-6-17(27-4)10-18(15)19)22(26)13-24-12-16-5-8-20-21(9-16)29-14-28-20;3-1(4)2(5)6/h5-11,24H,12-14H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | XPVSKLIJMZSDFX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|