About 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane
10-but-3-ynyl-6,10-diazaspiro[4.6]undecane (PubChem CID 64949036) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane.
Molecular Properties
| Compound Name | 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane |
| PubChem CID | 64949036 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane |
| SMILES | C#CCCN1CCCNC2(CCCC2)C1 |
| InChI | InChI=1S/C13H22N2/c1-2-3-10-15-11-6-9-14-13(12-15)7-4-5-8-13/h1,14H,3-12H2 |
| InChIKey | RGAVEMWBMBBCSH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane?
The IUPAC name of 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane (CID 64949036) is 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane.
What is the SMILES notation for 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane?
The canonical SMILES for 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane is C#CCCN1CCCNC2(CCCC2)C1.
What is the InChIKey of 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane?
The InChIKey is RGAVEMWBMBBCSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-2-3-10-15-11-6-9-14-13(12-15)7-4-5-8-13/h1,14H,3-12H2.
What are the key properties of 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane?
10-but-3-ynyl-6,10-diazaspiro[4.6]undecane has a molecular weight of 206.33 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-but-3-ynyl-6,10-diazaspiro[4.6]undecane is sourced from PubChem (CID 64949036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).