C17H22N4 — CID 64949388
1-[(5-methylpyrazin-2-yl)methyl]-3-phenyl-1,4-diazepane (PubChem CID 64949388) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[(5-methylpyrazin-2-yl)methyl]-3-phenyl-1,4-diazepane.
| Compound Name | 1-[(5-methylpyrazin-2-yl)methyl]-3-phenyl-1,4-diazepane |
|---|---|
| PubChem CID | 64949388 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[(5-methylpyrazin-2-yl)methyl]-3-phenyl-1,4-diazepane |
| SMILES | Cc1cnc(CN2CCCNC(c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C17H22N4/c1-14-10-20-16(11-19-14)12-21-9-5-8-18-17(13-21)15-6-3-2-4-7-15/h2-4,6-7,10-11,17-18H,5,8-9,12-13H2,1H3 |
| InChIKey | RIHSDJMHGJSYOZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |