C16H21N3S — CID 64949839
2-[1-(3-phenyl-1,4-diazepan-1-yl)ethyl]-1,3-thiazole (PubChem CID 64949839) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-[1-(3-phenyl-1,4-diazepan-1-yl)ethyl]-1,3-thiazole.
| Compound Name | 2-[1-(3-phenyl-1,4-diazepan-1-yl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 64949839 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[1-(3-phenyl-1,4-diazepan-1-yl)ethyl]-1,3-thiazole |
| SMILES | CC(c1nccs1)N1CCCNC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H21N3S/c1-13(16-18-9-11-20-16)19-10-5-8-17-15(12-19)14-6-3-2-4-7-14/h2-4,6-7,9,11,13,15,17H,5,8,10,12H2,1H3 |
| InChIKey | GBHXRNAIKXUHNX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |