C12H15FN2O2 — CID 64950702
(3-fluoro-4-pyridinyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 64950702) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (3-fluoro-4-pyridinyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 64950702 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccncc1F)N1CCCCC1CO |
| InChI | InChI=1S/C12H15FN2O2/c13-11-7-14-5-4-10(11)12(17)15-6-2-1-3-9(15)8-16/h4-5,7,9,16H,1-3,6,8H2 |
| InChIKey | VQKHOJQLAPNITF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |