About 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole
5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole (PubChem CID 64951129) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole |
| PubChem CID | 64951129 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole |
| SMILES | CCC(C)C1CN(Cc2cc(C)no2)CCCN1 |
| InChI | InChI=1S/C14H25N3O/c1-4-11(2)14-10-17(7-5-6-15-14)9-13-8-12(3)16-18-13/h8,11,14-15H,4-7,9-10H2,1-3H3 |
| InChIKey | GYVMJGHJUYNJER-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole?
The IUPAC name of 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole (CID 64951129) is 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole.
What is the SMILES notation for 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole?
The canonical SMILES for 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole is CCC(C)C1CN(Cc2cc(C)no2)CCCN1.
What is the InChIKey of 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole?
The InChIKey is GYVMJGHJUYNJER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-4-11(2)14-10-17(7-5-6-15-14)9-13-8-12(3)16-18-13/h8,11,14-15H,4-7,9-10H2,1-3H3.
What are the key properties of 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole?
5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole has a molecular weight of 251.37 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-butan-2-yl-1,4-diazepan-1-yl)methyl]-3-methyl-1,2-oxazole is sourced from PubChem (CID 64951129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).