C14H14FN3O — CID 64951287
3-fluoro-N-[2-(methylaminomethyl)phenyl]pyridine-4-carboxamide (PubChem CID 64951287) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is 3-fluoro-N-[2-(methylaminomethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[2-(methylaminomethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 64951287 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-fluoro-N-[2-(methylaminomethyl)phenyl]pyridine-4-carboxamide |
| SMILES | CNCc1ccccc1NC(=O)c1ccncc1F |
| InChI | InChI=1S/C14H14FN3O/c1-16-8-10-4-2-3-5-13(10)18-14(19)11-6-7-17-9-12(11)15/h2-7,9,16H,8H2,1H3,(H,18,19) |
| InChIKey | DRNKPELDAWENBR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |