About 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide
3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide (PubChem CID 64951593) has the molecular formula C15H28N2O2S
and a molecular weight of 300.47 g/mol. Its IUPAC name is 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide |
| PubChem CID | 64951593 |
| Molecular Formula | C15H28N2O2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(N2CCCNC3(CCCCC3)C2)C1 |
| InChI | InChI=1S/C15H28N2O2S/c18-20(19)11-4-6-14(12-20)17-10-5-9-16-15(13-17)7-2-1-3-8-15/h14,16H,1-13H2 |
| InChIKey | LHOBRSXQHPCNLN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide?
The IUPAC name of 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide (CID 64951593) is 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide.
What is the SMILES notation for 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide?
The canonical SMILES for 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide is O=S1(=O)CCCC(N2CCCNC3(CCCCC3)C2)C1.
What is the InChIKey of 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide?
The InChIKey is LHOBRSXQHPCNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O2S/c18-20(19)11-4-6-14(12-20)17-10-5-9-16-15(13-17)7-2-1-3-8-15/h14,16H,1-13H2.
What are the key properties of 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide?
3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide has a molecular weight of 300.47 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7,11-diazaspiro[5.6]dodecan-11-yl)thiane 1,1-dioxide is sourced from PubChem (CID 64951593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).