C18H28N2 — CID 64952228
1-(1-cyclopropylbutan-2-yl)-3-methyl-3-phenylpiperazine (PubChem CID 64952228) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-(1-cyclopropylbutan-2-yl)-3-methyl-3-phenylpiperazine.
| Compound Name | 1-(1-cyclopropylbutan-2-yl)-3-methyl-3-phenylpiperazine |
|---|---|
| PubChem CID | 64952228 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-(1-cyclopropylbutan-2-yl)-3-methyl-3-phenylpiperazine |
| SMILES | CCC(CC1CC1)N1CCNC(C)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H28N2/c1-3-17(13-15-9-10-15)20-12-11-19-18(2,14-20)16-7-5-4-6-8-16/h4-8,15,17,19H,3,9-14H2,1-2H3 |
| InChIKey | UXZZYABOZOJOKF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |