C13H26N2 — CID 64953434
1-(2,4-dimethylcyclohexyl)-3-methylpiperazine (PubChem CID 64953434) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(2,4-dimethylcyclohexyl)-3-methylpiperazine.
| Compound Name | 1-(2,4-dimethylcyclohexyl)-3-methylpiperazine |
|---|---|
| PubChem CID | 64953434 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-(2,4-dimethylcyclohexyl)-3-methylpiperazine |
| SMILES | CC1CCC(N2CCNC(C)C2)C(C)C1 |
| InChI | InChI=1S/C13H26N2/c1-10-4-5-13(11(2)8-10)15-7-6-14-12(3)9-15/h10-14H,4-9H2,1-3H3 |
| InChIKey | HFGKGAKPIORIOZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |