C22H24N4O4S — CID 649546
6-(3,4-dimethoxyphenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine (PubChem CID 649546) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 649546 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine |
| SMILES | COc1ccc(-c2ccc(Nc3ccc(S(=O)(=O)N4CCCC4)cc3)nn2)cc1OC |
| InChI | InChI=1S/C22H24N4O4S/c1-29-20-11-5-16(15-21(20)30-2)19-10-12-22(25-24-19)23-17-6-8-18(9-7-17)31(27,28)26-13-3-4-14-26/h5-12,15H,3-4,13-14H2,1-2H3,(H,23,25) |
| InChIKey | PJWWNLGVUDWUGA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |