About 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide
3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide (PubChem CID 649549) has the molecular formula C10H19NO4S2
and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide |
| PubChem CID | 649549 |
| Molecular Formula | C10H19NO4S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCCCCC2)C1 |
| InChI | InChI=1S/C10H19NO4S2/c12-16(13)8-5-10(9-16)17(14,15)11-6-3-1-2-4-7-11/h10H,1-9H2 |
| InChIKey | FQWRTAYXCRQAHY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide?
The IUPAC name of 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide (CID 649549) is 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide.
What is the SMILES notation for 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide?
The canonical SMILES for 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide is O=S1(=O)CCC(S(=O)(=O)N2CCCCCC2)C1.
What is the InChIKey of 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide?
The InChIKey is FQWRTAYXCRQAHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4S2/c12-16(13)8-5-10(9-16)17(14,15)11-6-3-1-2-4-7-11/h10H,1-9H2.
What are the key properties of 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide?
3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide has a molecular weight of 281.40 g/mol, XLogP of 0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azepan-1-ylsulfonyl)thiolane 1,1-dioxide is sourced from PubChem (CID 649549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).