C11H9F3N2O2 — CID 64956628
1-(2,3,4-trifluorophenyl)-1,4-diazepane-2,5-dione (PubChem CID 64956628) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is 1-(2,3,4-trifluorophenyl)-1,4-diazepane-2,5-dione.
| Compound Name | 1-(2,3,4-trifluorophenyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64956628 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-(2,3,4-trifluorophenyl)-1,4-diazepane-2,5-dione |
| SMILES | O=C1CCN(c2ccc(F)c(F)c2F)C(=O)CN1 |
| InChI | InChI=1S/C11H9F3N2O2/c12-6-1-2-7(11(14)10(6)13)16-4-3-8(17)15-5-9(16)18/h1-2H,3-5H2,(H,15,17) |
| InChIKey | VBUMZHSHASOVIZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|