C14H15F3N2O2 — CID 64956770
6-ethyl-3,3-dimethyl-1-(2,3,4-trifluorophenyl)piperazine-2,5-dione (PubChem CID 64956770) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 6-ethyl-3,3-dimethyl-1-(2,3,4-trifluorophenyl)piperazine-2,5-dione.
| Compound Name | 6-ethyl-3,3-dimethyl-1-(2,3,4-trifluorophenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64956770 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 6-ethyl-3,3-dimethyl-1-(2,3,4-trifluorophenyl)piperazine-2,5-dione |
| SMILES | CCC1C(=O)NC(C)(C)C(=O)N1c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H15F3N2O2/c1-4-8-12(20)18-14(2,3)13(21)19(8)9-6-5-7(15)10(16)11(9)17/h5-6,8H,4H2,1-3H3,(H,18,20) |
| InChIKey | FNEAOPADNUFIDO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|