C15H18F2N2O2 — CID 64958952
1-(3,5-difluorophenyl)-3,3-diethyl-6-methylpiperazine-2,5-dione (PubChem CID 64958952) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3,3-diethyl-6-methylpiperazine-2,5-dione.
| Compound Name | 1-(3,5-difluorophenyl)-3,3-diethyl-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64958952 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3,3-diethyl-6-methylpiperazine-2,5-dione |
| SMILES | CCC1(CC)NC(=O)C(C)N(c2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C15H18F2N2O2/c1-4-15(5-2)14(21)19(9(3)13(20)18-15)12-7-10(16)6-11(17)8-12/h6-9H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | DCERMKUWOFVBGC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |