C13H16N2O2 — CID 64959098
1-(3-ethylphenyl)-1,4-diazepane-2,5-dione (PubChem CID 64959098) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-1,4-diazepane-2,5-dione.
| Compound Name | 1-(3-ethylphenyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64959098 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-(3-ethylphenyl)-1,4-diazepane-2,5-dione |
| SMILES | CCc1cccc(N2CCC(=O)NCC2=O)c1 |
| InChI | InChI=1S/C13H16N2O2/c1-2-10-4-3-5-11(8-10)15-7-6-12(16)14-9-13(15)17/h3-5,8H,2,6-7,9H2,1H3,(H,14,16) |
| InChIKey | SKBGDICIRXSNHF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |