About 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione
11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione (PubChem CID 64959626) has the molecular formula C17H22N2O2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione.
Molecular Properties
| Compound Name | 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione |
| PubChem CID | 64959626 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione |
| SMILES | Cc1cccc(N2CCC(=O)NC3(CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C17H22N2O2/c1-13-6-5-7-14(12-13)19-11-8-15(20)18-17(16(19)21)9-3-2-4-10-17/h5-7,12H,2-4,8-11H2,1H3,(H,18,20) |
| InChIKey | VUVOCTSKRGYWIQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione?
The IUPAC name of 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione (CID 64959626) is 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione.
What is the SMILES notation for 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione?
The canonical SMILES for 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione is Cc1cccc(N2CCC(=O)NC3(CCCCC3)C2=O)c1.
What is the InChIKey of 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione?
The InChIKey is VUVOCTSKRGYWIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2/c1-13-6-5-7-14(12-13)19-11-8-15(20)18-17(16(19)21)9-3-2-4-10-17/h5-7,12H,2-4,8-11H2,1H3,(H,18,20).
What are the key properties of 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione?
11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione has a molecular weight of 286.38 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(3-methylphenyl)-7,11-diazaspiro[5.6]dodecane-8,12-dione is sourced from PubChem (CID 64959626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).