C14H16F2N2O2 — CID 64960024
3-butan-2-yl-1-(2,6-difluorophenyl)piperazine-2,5-dione (PubChem CID 64960024) has the molecular formula C14H16F2N2O2 and a molecular weight of 282.29 g/mol. Its IUPAC name is 3-butan-2-yl-1-(2,6-difluorophenyl)piperazine-2,5-dione.
| Compound Name | 3-butan-2-yl-1-(2,6-difluorophenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64960024 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-butan-2-yl-1-(2,6-difluorophenyl)piperazine-2,5-dione |
| SMILES | CCC(C)C1NC(=O)CN(c2c(F)cccc2F)C1=O |
| InChI | InChI=1S/C14H16F2N2O2/c1-3-8(2)12-14(20)18(7-11(19)17-12)13-9(15)5-4-6-10(13)16/h4-6,8,12H,3,7H2,1-2H3,(H,17,19) |
| InChIKey | ZCGDORRNESILCF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |