C15H24N4O2 — CID 64961099
3-butan-2-yl-6-ethyl-1-(1-ethylpyrazol-4-yl)piperazine-2,5-dione (PubChem CID 64961099) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-butan-2-yl-6-ethyl-1-(1-ethylpyrazol-4-yl)piperazine-2,5-dione.
| Compound Name | 3-butan-2-yl-6-ethyl-1-(1-ethylpyrazol-4-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64961099 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-butan-2-yl-6-ethyl-1-(1-ethylpyrazol-4-yl)piperazine-2,5-dione |
| SMILES | CCC(C)C1NC(=O)C(CC)N(c2cnn(CC)c2)C1=O |
| InChI | InChI=1S/C15H24N4O2/c1-5-10(4)13-15(21)19(12(6-2)14(20)17-13)11-8-16-18(7-3)9-11/h8-10,12-13H,5-7H2,1-4H3,(H,17,20) |
| InChIKey | LCUWVUAKKQCYAE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |