C15H16Cl2N2O2 — CID 64961192
4-(3,4-dichlorophenyl)-1,4-diazaspiro[5.5]undecane-2,5-dione (PubChem CID 64961192) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-1,4-diazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 4-(3,4-dichlorophenyl)-1,4-diazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 64961192 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-1,4-diazaspiro[5.5]undecane-2,5-dione |
| SMILES | O=C1CN(c2ccc(Cl)c(Cl)c2)C(=O)C2(CCCCC2)N1 |
| InChI | InChI=1S/C15H16Cl2N2O2/c16-11-5-4-10(8-12(11)17)19-9-13(20)18-15(14(19)21)6-2-1-3-7-15/h4-5,8H,1-3,6-7,9H2,(H,18,20) |
| InChIKey | XMJLMMCUODTTHA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |