About 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione
9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64961297) has the molecular formula C14H15ClN2O2
and a molecular weight of 278.74 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
Molecular Properties
| Compound Name | 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| PubChem CID | 64961297 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | O=C1CN(c2ccc(Cl)cc2)C(=O)C2(CCCC2)N1 |
| InChI | InChI=1S/C14H15ClN2O2/c15-10-3-5-11(6-4-10)17-9-12(18)16-14(13(17)19)7-1-2-8-14/h3-6H,1-2,7-9H2,(H,16,18) |
| InChIKey | DVYMCYJXIWVQFS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione?
The IUPAC name of 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione (CID 64961297) is 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
What is the SMILES notation for 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione?
The canonical SMILES for 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione is O=C1CN(c2ccc(Cl)cc2)C(=O)C2(CCCC2)N1.
What is the InChIKey of 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione?
The InChIKey is DVYMCYJXIWVQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O2/c15-10-3-5-11(6-4-10)17-9-12(18)16-14(13(17)19)7-1-2-8-14/h3-6H,1-2,7-9H2,(H,16,18).
What are the key properties of 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione?
9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione has a molecular weight of 278.74 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-chlorophenyl)-6,9-diazaspiro[4.5]decane-7,10-dione is sourced from PubChem (CID 64961297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).