C19H21N3O3S — CID 6496339
5-(2-ethoxyphenyl)-1-methyl-2-prop-2-enylsulfanyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 6496339) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 5-(2-ethoxyphenyl)-1-methyl-2-prop-2-enylsulfanyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-ethoxyphenyl)-1-methyl-2-prop-2-enylsulfanyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 6496339 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 5-(2-ethoxyphenyl)-1-methyl-2-prop-2-enylsulfanyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | C=CCSc1nc(=O)c2c(n1C)NC(=O)CC2c1ccccc1OCC |
| InChI | InChI=1S/C19H21N3O3S/c1-4-10-26-19-21-18(24)16-13(11-15(23)20-17(16)22(19)3)12-8-6-7-9-14(12)25-5-2/h4,6-9,13H,1,5,10-11H2,2-3H3,(H,20,23) |
| InChIKey | QRSWHTSBBLWLEI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|