C13H14BrClN2O2 — CID 64963404
1-(4-bromo-2-chlorophenyl)-3,3,6-trimethylpiperazine-2,5-dione (PubChem CID 64963404) has the molecular formula C13H14BrClN2O2 and a molecular weight of 345.62 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3,3,6-trimethylpiperazine-2,5-dione.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3,3,6-trimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64963404 |
| Molecular Formula | C13H14BrClN2O2 |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3,3,6-trimethylpiperazine-2,5-dione |
| SMILES | CC1C(=O)NC(C)(C)C(=O)N1c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H14BrClN2O2/c1-7-11(18)16-13(2,3)12(19)17(7)10-5-4-8(14)6-9(10)15/h4-7H,1-3H3,(H,16,18) |
| InChIKey | CUJKOROWCSUKMP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |