C21H24N6O2 — CID 649637
N-(4-methoxyphenyl)-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidine-3-carboxamide (PubChem CID 649637) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidine-3-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 649637 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-(4-methoxyphenyl)-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN(c3c4c(nc5ncnn35)CCC4)C2)cc1 |
| InChI | InChI=1S/C21H24N6O2/c1-29-16-9-7-15(8-10-16)24-19(28)14-4-3-11-26(12-14)20-17-5-2-6-18(17)25-21-22-13-23-27(20)21/h7-10,13-14H,2-6,11-12H2,1H3,(H,24,28) |
| InChIKey | HRZTUOJNWOXTRD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |