About 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione
1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 64964078) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione |
| PubChem CID | 64964078 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)C1C(=O)NCC(=O)N1CC1COCCO1 |
| InChI | InChI=1S/C12H20N2O4/c1-8(2)11-12(16)13-5-10(15)14(11)6-9-7-17-3-4-18-9/h8-9,11H,3-7H2,1-2H3,(H,13,16) |
| InChIKey | FIYRGIVCFLANRD-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione?
The IUPAC name of 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione (CID 64964078) is 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione.
What is the SMILES notation for 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione?
The canonical SMILES for 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione is CC(C)C1C(=O)NCC(=O)N1CC1COCCO1.
What is the InChIKey of 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione?
The InChIKey is FIYRGIVCFLANRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4/c1-8(2)11-12(16)13-5-10(15)14(11)6-9-7-17-3-4-18-9/h8-9,11H,3-7H2,1-2H3,(H,13,16).
What are the key properties of 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione?
1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione has a molecular weight of 256.30 g/mol, XLogP of -0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dioxan-2-ylmethyl)-6-propan-2-ylpiperazine-2,5-dione is sourced from PubChem (CID 64964078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).