About 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione
1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione (PubChem CID 64965262) has the molecular formula C14H16ClFN2O2
and a molecular weight of 298.75 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione |
| PubChem CID | 64965262 |
| Molecular Formula | C14H16ClFN2O2 |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(CC)N(c2ccc(Cl)cc2F)C1=O |
| InChI | InChI=1S/C14H16ClFN2O2/c1-3-10-14(20)18(11(4-2)13(19)17-10)12-6-5-8(15)7-9(12)16/h5-7,10-11H,3-4H2,1-2H3,(H,17,19) |
| InChIKey | OOWKOOILWQPEOP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione?
The IUPAC name of 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione (CID 64965262) is 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione.
What is the SMILES notation for 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione?
The canonical SMILES for 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione is CCC1NC(=O)C(CC)N(c2ccc(Cl)cc2F)C1=O.
What is the InChIKey of 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione?
The InChIKey is OOWKOOILWQPEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClFN2O2/c1-3-10-14(20)18(11(4-2)13(19)17-10)12-6-5-8(15)7-9(12)16/h5-7,10-11H,3-4H2,1-2H3,(H,17,19).
What are the key properties of 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione?
1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione has a molecular weight of 298.75 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2-fluorophenyl)-3,6-diethylpiperazine-2,5-dione is sourced from PubChem (CID 64965262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).