C15H22N2O2S — CID 64966335
3,3-dimethyl-1-(1-thiophen-2-ylbutyl)-1,4-diazepane-2,5-dione (PubChem CID 64966335) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1-thiophen-2-ylbutyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3,3-dimethyl-1-(1-thiophen-2-ylbutyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64966335 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3,3-dimethyl-1-(1-thiophen-2-ylbutyl)-1,4-diazepane-2,5-dione |
| SMILES | CCCC(c1cccs1)N1CCC(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C15H22N2O2S/c1-4-6-11(12-7-5-10-20-12)17-9-8-13(18)16-15(2,3)14(17)19/h5,7,10-11H,4,6,8-9H2,1-3H3,(H,16,18) |
| InChIKey | WBGDGVDQOIVXAI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |