About 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione
3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione (PubChem CID 64966359) has the molecular formula C9H11N3O2S
and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione |
| PubChem CID | 64966359 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione |
| SMILES | CC1NC(=O)CN(Cc2nccs2)C1=O |
| InChI | InChI=1S/C9H11N3O2S/c1-6-9(14)12(4-7(13)11-6)5-8-10-2-3-15-8/h2-3,6H,4-5H2,1H3,(H,11,13) |
| InChIKey | MSUWECNDODHXJU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione?
The IUPAC name of 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione (CID 64966359) is 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione.
What is the SMILES notation for 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione?
The canonical SMILES for 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione is CC1NC(=O)CN(Cc2nccs2)C1=O.
What is the InChIKey of 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione?
The InChIKey is MSUWECNDODHXJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2S/c1-6-9(14)12(4-7(13)11-6)5-8-10-2-3-15-8/h2-3,6H,4-5H2,1H3,(H,11,13).
What are the key properties of 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione?
3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione has a molecular weight of 225.27 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione is sourced from PubChem (CID 64966359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).