C23H24N2O5 — CID 6496733
1-pyridin-3-yl-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 6496733) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-pyridin-3-yl-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | 1-pyridin-3-yl-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 6496733 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-pyridin-3-yl-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | COc1cc(OC)c(C2CC(=O)N(c3cccnc3)C3=C2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C23H24N2O5/c1-28-19-12-21(30-3)20(29-2)10-15(19)16-11-22(27)25(14-6-5-9-24-13-14)17-7-4-8-18(26)23(16)17/h5-6,9-10,12-13,16H,4,7-8,11H2,1-3H3 |
| InChIKey | AHOPYGFEYCADLZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |