About 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one
1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one (PubChem CID 649679) has the molecular formula C15H17N3OS
and a molecular weight of 287.39 g/mol. Its IUPAC name is 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one |
| PubChem CID | 649679 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCc2cc(-c3csc(N)n3)ccc21 |
| InChI | InChI=1S/C15H17N3OS/c1-9(2)14(19)18-6-5-11-7-10(3-4-13(11)18)12-8-20-15(16)17-12/h3-4,7-9H,5-6H2,1-2H3,(H2,16,17) |
| InChIKey | AKPUNMZEIIAZFH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one?
The IUPAC name of 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one (CID 649679) is 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one.
What is the SMILES notation for 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one?
The canonical SMILES for 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one is CC(C)C(=O)N1CCc2cc(-c3csc(N)n3)ccc21.
What is the InChIKey of 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one?
The InChIKey is AKPUNMZEIIAZFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3OS/c1-9(2)14(19)18-6-5-11-7-10(3-4-13(11)18)12-8-20-15(16)17-12/h3-4,7-9H,5-6H2,1-2H3,(H2,16,17).
What are the key properties of 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one?
1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one has a molecular weight of 287.39 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-amino-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one is sourced from PubChem (CID 649679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).