C9H15N5O — CID 6496898
[3-(oxolan-2-ylmethyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]cyanamide (PubChem CID 6496898) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is [3-(oxolan-2-ylmethyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]cyanamide.
| Compound Name | [3-(oxolan-2-ylmethyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]cyanamide |
|---|---|
| PubChem CID | 6496898 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | [3-(oxolan-2-ylmethyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]cyanamide |
| SMILES | N#CNC1=NCN(CC2CCCO2)CN1 |
| InChI | InChI=1S/C9H15N5O/c10-5-11-9-12-6-14(7-13-9)4-8-2-1-3-15-8/h8H,1-4,6-7H2,(H2,11,12,13) |
| InChIKey | FUJNLSJSEZLRPK-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|