C17H28N2O2 — CID 64969194
9-(1-cyclohexylpropyl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64969194) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 9-(1-cyclohexylpropyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 9-(1-cyclohexylpropyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 64969194 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 9-(1-cyclohexylpropyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | CCC(C1CCCCC1)N1CC(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C17H28N2O2/c1-2-14(13-8-4-3-5-9-13)19-12-15(20)18-17(16(19)21)10-6-7-11-17/h13-14H,2-12H2,1H3,(H,18,20) |
| InChIKey | YCUFSNYFKICGRG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |