C13H11F3N2O2 — CID 64969795
3-cyclopropyl-1-(2,4,5-trifluorophenyl)piperazine-2,5-dione (PubChem CID 64969795) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,4,5-trifluorophenyl)piperazine-2,5-dione.
| Compound Name | 3-cyclopropyl-1-(2,4,5-trifluorophenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64969795 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-cyclopropyl-1-(2,4,5-trifluorophenyl)piperazine-2,5-dione |
| SMILES | O=C1CN(c2cc(F)c(F)cc2F)C(=O)C(C2CC2)N1 |
| InChI | InChI=1S/C13H11F3N2O2/c14-7-3-9(16)10(4-8(7)15)18-5-11(19)17-12(13(18)20)6-1-2-6/h3-4,6,12H,1-2,5H2,(H,17,19) |
| InChIKey | NSZQWHKBDPKYNE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|