About 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione
3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione (PubChem CID 64970556) has the molecular formula C12H17N3O2S
and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione.
Molecular Properties
| Compound Name | 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione |
| PubChem CID | 64970556 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione |
| SMILES | CCC1NC(=O)CN(CCc2nc(C)cs2)C1=O |
| InChI | InChI=1S/C12H17N3O2S/c1-3-9-12(17)15(6-10(16)14-9)5-4-11-13-8(2)7-18-11/h7,9H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | VNRCYXDQLXUWNR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione?
The IUPAC name of 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione (CID 64970556) is 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione.
What is the SMILES notation for 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione?
The canonical SMILES for 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione is CCC1NC(=O)CN(CCc2nc(C)cs2)C1=O.
What is the InChIKey of 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione?
The InChIKey is VNRCYXDQLXUWNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2S/c1-3-9-12(17)15(6-10(16)14-9)5-4-11-13-8(2)7-18-11/h7,9H,3-6H2,1-2H3,(H,14,16).
What are the key properties of 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione?
3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione has a molecular weight of 267.35 g/mol, XLogP of 0.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione is sourced from PubChem (CID 64970556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).