About [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate
[2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 6497082) has the molecular formula C18H18O5
and a molecular weight of 314.34 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
Molecular Properties
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| PubChem CID | 6497082 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)C2C3CC4OC(=O)C2C4C3)cc1 |
| InChI | InChI=1S/C18H18O5/c1-9-2-4-10(5-3-9)13(19)8-22-17(20)15-11-6-12-14(7-11)23-18(21)16(12)15/h2-5,11-12,14-16H,6-8H2,1H3 |
| InChIKey | PEBUXYDTCLGVRK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The IUPAC name of [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (CID 6497082) is [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
What is the SMILES notation for [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The canonical SMILES for [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is Cc1ccc(C(=O)COC(=O)C2C3CC4OC(=O)C2C4C3)cc1.
What is the InChIKey of [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The InChIKey is PEBUXYDTCLGVRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O5/c1-9-2-4-10(5-3-9)13(19)8-22-17(20)15-11-6-12-14(7-11)23-18(21)16(12)15/h2-5,11-12,14-16H,6-8H2,1H3.
What are the key properties of [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
[2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate has a molecular weight of 314.34 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is sourced from PubChem (CID 6497082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).