C15H12IN5O — CID 6497099
N-(4-iodo-2-methylphenyl)-2-(1,2,4-triazol-4-yl)pyridine-4-carboxamide (PubChem CID 6497099) has the molecular formula C15H12IN5O and a molecular weight of 405.20 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-(1,2,4-triazol-4-yl)pyridine-4-carboxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-(1,2,4-triazol-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6497099 |
| Molecular Formula | C15H12IN5O |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-(1,2,4-triazol-4-yl)pyridine-4-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)c1ccnc(-n2cnnc2)c1 |
| InChI | InChI=1S/C15H12IN5O/c1-10-6-12(16)2-3-13(10)20-15(22)11-4-5-17-14(7-11)21-8-18-19-9-21/h2-9H,1H3,(H,20,22) |
| InChIKey | PUOJZDWBIRSIEX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|